Difference between revisions of "Ec-15 000240"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * smiles: ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-15_000240 == * left end position: ** 429838 * transcription direction: ** POSITIVE * right end position: ** 437706 * centisome position: ** 7.9625...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_000240 == |
− | * | + | * left end position: |
− | ** | + | ** 429838 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 437706 |
− | * | + | * centisome position: |
− | ** | + | ** 7.962539 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0012_0136 |
− | ** | + | ** Esi0012_0136 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-12086]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[RXN-12579]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | * Reaction: [[TRIACYLGLYCEROL-LIPASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[LIPAS-PWY]] | ||
+ | * [[PWY-6857]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=429838}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=437706}} | |
− | + | {{#set: centisome position=7.962539 }} | |
− | + | {{#set: common name=Esi_0012_0136|Esi0012_0136}} | |
− | + | {{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}} | |
− | + | {{#set: pathway associated=LIPAS-PWY|PWY-6857}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:18, 21 March 2018
Gene Ec-15_000240
- left end position:
- 429838
- transcription direction:
- POSITIVE
- right end position:
- 437706
- centisome position:
- 7.962539
- Synonym(s):
- Esi_0012_0136
- Esi0012_0136
Reactions associated
- Reaction: RXN-12086
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12579
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: TRIACYLGLYCEROL-LIPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome