Difference between revisions of "Ec-25 003740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Ec-25_003740 == * left end position: ** 4305379 * transcription direction: ** NEGATIVE * right end position: ** 4310520 * centisome position: ** 96.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
+
== Gene Ec-25_003740 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
+
** 4305379
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-hydroxy-2-nonenal-[L-Cys] conjugate
+
** 4310520
−
* molecular weight:
+
* centisome position:
−
** 277.378    
+
** 96.7297    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0300_0009
 +
** Esi0300_0009
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.4.21.53-RXN]]
−
* [[RXN-13677]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4305379}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657989 90657989]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]}}
+
{{#set: right end position=4310520}}
−
{{#set: inchi key=InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N}}
+
{{#set: centisome position=96.7297    }}
−
{{#set: common name=4-hydroxy-2-nonenal-[L-Cys] conjugate}}
+
{{#set: common name=Esi_0300_0009|Esi0300_0009}}
−
{{#set: molecular weight=277.378    }}
+
{{#set: reaction associated=3.4.21.53-RXN}}
−
{{#set: produced by=RXN-13677}}
+

Latest revision as of 19:18, 21 March 2018

Gene Ec-25_003740

  • left end position:
    • 4305379
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4310520
  • centisome position:
    • 96.7297
  • Synonym(s):
    • Esi_0300_0009
    • Esi0300_0009

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-25_003740&oldid=25973"