Difference between revisions of "Ec-16 001360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * in...") |
(Created page with "Category:Gene == Gene Ec-16_001360 == * left end position: ** 1508568 * transcription direction: ** NEGATIVE * right end position: ** 1524985 * centisome position: ** 28.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_001360 == |
− | * | + | * left end position: |
− | ** | + | ** 1508568 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1524985 |
− | * | + | * centisome position: |
− | ** | + | ** 28.262753 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0194_0029 |
− | ** | + | ** Esi0194_0029 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1508568}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1524985}} | |
− | + | {{#set: centisome position=28.262753 }} | |
− | + | {{#set: common name=Esi_0194_0029|Esi0194_0029}} | |
− | + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:18, 21 March 2018
Gene Ec-16_001360
- left end position:
- 1508568
- transcription direction:
- NEGATIVE
- right end position:
- 1524985
- centisome position:
- 28.262753
- Synonym(s):
- Esi_0194_0029
- Esi0194_0029
Reactions associated
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome