Difference between revisions of "CPD-6991"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMMONIUM AMMONIUM] == * smiles: ** [NH4+] * inchi key: ** InChIKey=QGZKDVFQNNGYKY-UHFFFAOYSA-O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (2S)-pinocembrin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 255.249 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7648]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7647]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMPK12140214 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200438 25200438] |
| − | * HMDB : | + | * HMDB : HMDB30808 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C09827 C09827] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28157 28157] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC28157 |
| − | {{#set: smiles=[ | + | {{#set: smiles=C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=(2S)-pinocembrin}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=255.249 }} |
| − | + | {{#set: consumed by=RXN-7648}} | |
| − | {{#set: consumed by= | + | {{#set: produced by=RXN-7647}} |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-6991
- smiles:
- C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)
- inchi key:
- InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M
- common name:
- (2S)-pinocembrin
- molecular weight:
- 255.249
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPK12140214
- PUBCHEM:
- HMDB : HMDB30808
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC28157
"C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)" cannot be used as a page name in this wiki.
