Difference between revisions of "RXN-1321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PPI PPI] == * smiles: ** O=P(O)(OP([O-])([O-])=O)[O-] * inchi key: ** InChIKey=XPPKVPWEQAFLFU-U...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1321 RXN-1321] == * direction: ** LEFT-TO-RIGHT * common name: ** Lipoxygenase * ec number: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1321 RXN-1321] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Lipoxygenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.13.11.12 EC-1.13.11.12] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | + | ** 1 [[LINOLENIC_ACID]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-725]][c] | |
− | * | + | * With common name(s): |
− | * [[ | + | ** 1 α-linolenate[c] '''+''' 1 oxygen[c] '''=>''' 1 13(S)-HPOTE[c] |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Ec-03_000010]] | |
− | + | ** Source: [[orthology-aragem]] | |
− | * | + | * Gene: [[Ec-03_000020]] |
− | * | + | ** Source: [[orthology-aragem]] |
− | * | + | * Gene: [[Ec-20_003620]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: AUTOMATED-NAME-MATCH | |
− | + | ** Source: [[orthology-aragem]] | |
− | + | * Gene: [[Ec-20_003630]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: AUTOMATED-NAME-MATCH | |
− | + | ** Source: [[orthology-aragem]] | |
− | + | == Pathways == | |
− | + | * [[PWY-5410]], traumatin and (Z)-3-hexen-1-yl acetate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] | |
− | + | ** '''1''' reactions found over '''9''' reactions in the full pathway | |
− | + | * [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735] | |
− | + | ** '''10''' reactions found over '''19''' reactions in the full pathway | |
− | + | == Reconstruction information == | |
− | + | * Category: [[orthology]] | |
− | + | ** Source: [[orthology-aragem]] | |
− | + | *** Tool: [[pantograph]] | |
− | + | * Category: [[annotation]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Tool: [[pathwaytools]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34495 34495] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07869 R07869] | |
− | ** [http:// | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=Lipoxygenase}} | |
− | * LIGAND- | + | {{#set: ec number=EC-1.13.11.12}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Ec-03_000010|Ec-03_000020|Ec-20_003620|Ec-20_003630}} |
− | + | {{#set: in pathway=PWY-5410|PWY-735}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:18, 21 March 2018
Contents
Reaction RXN-1321
- direction:
- LEFT-TO-RIGHT
- common name:
- Lipoxygenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 LINOLENIC_ACID[c] + 1 OXYGEN-MOLECULE[c] => 1 CPD-725[c]
- With common name(s):
- 1 α-linolenate[c] + 1 oxygen[c] => 1 13(S)-HPOTE[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-03_000010
- Source: orthology-aragem
- Gene: Ec-03_000020
- Source: orthology-aragem
- Gene: Ec-20_003620
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-20_003630
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5410, traumatin and (Z)-3-hexen-1-yl acetate biosynthesis: PWY-5410
- 1 reactions found over 9 reactions in the full pathway
- PWY-735, jasmonic acid biosynthesis: PWY-735
- 10 reactions found over 19 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links