Difference between revisions of "Ec-03 004240"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...") |
(Created page with "Category:Gene == Gene Ec-03_004240 == * left end position: ** 4862122 * transcription direction: ** NEGATIVE * right end position: ** 4870996 * centisome position: ** 74.4...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-03_004240 == |
− | * | + | * left end position: |
− | ** | + | ** 4862122 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4870996 |
− | * | + | * centisome position: |
− | ** | + | ** 74.473495 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0097_0016 |
− | ** | + | ** Esi0097_0016 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[PWY-1001]] |
== External links == | == External links == | ||
− | + | {{#set: left end position=4862122}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4870996}} | |
− | + | {{#set: centisome position=74.473495 }} | |
− | + | {{#set: common name=Esi_0097_0016|Esi0097_0016}} | |
− | + | {{#set: reaction associated=CELLULOSE-SYNTHASE-UDP-FORMING-RXN}} | |
− | + | {{#set: pathway associated=PWY-1001}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:18, 21 March 2018
Gene Ec-03_004240
- left end position:
- 4862122
- transcription direction:
- NEGATIVE
- right end position:
- 4870996
- centisome position:
- 74.473495
- Synonym(s):
- Esi_0097_0016
- Esi0097_0016
Reactions associated
- Reaction: CELLULOSE-SYNTHASE-UDP-FORMING-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome