Difference between revisions of "CGMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1353 PWY0-1353] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * smiles: ** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-])) * in...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1353 PWY0-1353] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
 +
* inchi key:
 +
** InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
 
* common name:
 
* common name:
−
** succinate to cytochrome bd oxidase electron transfer
+
** cyclic-GMP
 +
* molecular weight:
 +
** 344.2   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3',5'-cyclic GMP
 +
** guanosine-cyclic-phosphoric-acid
 +
** cGMP
 +
** guanosine cyclic-monophosphate
 +
** guanosine 3',5'-cyclic-monophosphate
 +
** guanosine 3',5'-cyclic phosphate
 +
** cyclic 3',5'-guanosine monophosphate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** 6 associated gene(s):
+
* [[GUANYLCYC-RXN]]
−
*** [[Ec-07_002870]]
+
−
*** [[Ec-07_007310]]
+
−
*** [[Ec-11_000360]]
+
−
*** [[Ec-21_003470]]
+
−
*** [[Ec-05_003640]]
+
−
*** [[Ec-27_006560]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5266 RXN0-5266]
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* CAS : 7665-99-8
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1353 PWY0-1353]
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16727415 16727415]
−
{{#set: common name=succinate to cytochrome bd oxidase electron transfer}}
+
* HMDB : HMDB01314
−
{{#set: reaction found=1}}
+
* LIGAND-CPD:
−
{{#set: total reaction=2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00942 C00942]
−
{{#set: completion rate=50.0}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.20559156.html 20559156]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57746 57746]
 +
* METABOLIGHTS : MTBLC57746
 +
{{#set: smiles=C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))}}
 +
{{#set: inchi key=InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M}}
 +
{{#set: common name=cyclic-GMP}}
 +
{{#set: molecular weight=344.2    }}
 +
{{#set: common name=3',5'-cyclic GMP|guanosine-cyclic-phosphoric-acid|cGMP|guanosine cyclic-monophosphate|guanosine 3',5'-cyclic-monophosphate|guanosine 3',5'-cyclic phosphate|cyclic 3',5'-guanosine monophosphate}}
 +
{{#set: reversible reaction associated=GUANYLCYC-RXN}}

Latest revision as of 19:19, 21 March 2018

Metabolite CGMP

  • smiles:
    • C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))
  • inchi key:
    • InChIKey=ZOOGRGPOEVQQDX-UUOKFMHZSA-M
  • common name:
    • cyclic-GMP
  • molecular weight:
    • 344.2
  • Synonym(s):
    • 3',5'-cyclic GMP
    • guanosine-cyclic-phosphoric-acid
    • cGMP
    • guanosine cyclic-monophosphate
    • guanosine 3',5'-cyclic-monophosphate
    • guanosine 3',5'-cyclic phosphate
    • cyclic 3',5'-guanosine monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C4(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)OP(O4)(=O)[O-]))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CGMP&oldid=26039"