|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALSYN-RXN MALSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23))) |
| + | * inchi key: |
| + | ** InChIKey=VGONTNSXDCQUGY-RRKCRQDMSA-N |
| * common name: | | * common name: |
− | ** Malate synthase | + | ** 2'-deoxyinosine |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.3.3.9 EC-2.3.3.9] | + | ** 252.229 |
| * Synonym(s): | | * Synonym(s): |
| + | ** deoxyinosine |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[ACETYL-COA]][c] '''+''' 1 [[GLYOX]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MAL]][c]
| + | * [[ADDALT-RXN]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 acetyl-CoA[c] '''+''' 1 glyoxylate[c] '''+''' 1 H2O[c] '''=>''' 1 coenzyme A[c] '''+''' 1 H+[c] '''+''' 1 (S)-malate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-12_003860]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-7295]], L-arabinose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295]
| + | |
− | ** '''3''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7294]], xylose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7294 PWY-7294]
| + | |
− | ** '''3''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[GLYOXDEG-PWY]], glycolate and glyoxylate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXDEG-PWY GLYOXDEG-PWY]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS]
| + | |
− | ** '''6''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728] | + | |
− | ** '''11''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-7118]], chitin degradation to ethanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118]
| + | |
− | ** '''3''' reactions found over '''6''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 890-38-0 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18181 18181]
| + | * BIGG : 45942 |
− | * PIR:
| + | * PUBCHEM: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40715 I40715]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65058 65058] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0195 JX0195]
| + | * HMDB : HMDB00071 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0196 JX0196] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S15387 S15387] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05512 C05512] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S17773 S17773] | + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S17774 S17774]
| + | ** [http://www.chemspider.com/Chemical-Structure.619.html 619] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S26645 S26645]
| + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S44186 S44186] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28997 28997] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S48493 S48493]
| + | * METABOLIGHTS : MTBLC28997 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S51788 S51788]
| + | {{#set: smiles=C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23)))}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=SYCNMU SYCNMU]
| + | {{#set: inchi key=InChIKey=VGONTNSXDCQUGY-RRKCRQDMSA-N}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=SYCSM2 SYCSM2]
| + | {{#set: common name=2'-deoxyinosine}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=SYECMA SYECMA]
| + | {{#set: molecular weight=252.229 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=SYHQMA SYHQMA]
| + | {{#set: common name=deoxyinosine}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=SYKVMA SYKVMA]
| + | {{#set: produced by=ADDALT-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=SYRPMA SYRPMA]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T03412 T03412]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07690 T07690]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T44752 T44752]
| + | |
− | * LIGAND-RXN: | + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00472 R00472] | + | |
− | * UNIPROT: | + | |
− | ** [http://www.uniprot.org/uniprot/P42450 P42450] | + | |
− | ** [http://www.uniprot.org/uniprot/Q02216 Q02216]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28344 P28344] | + | |
− | ** [http://www.uniprot.org/uniprot/P28345 P28345] | + | |
− | ** [http://www.uniprot.org/uniprot/P30952 P30952]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43827 Q43827]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21826 P21826] | + | |
− | ** [http://www.uniprot.org/uniprot/P37330 P37330]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17432 P17432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17815 P17815]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08997 P08997]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21360 P21360]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08216 P08216]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13244 P13244]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49081 P49081]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45458 P45458]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32913 O32913]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=Malate synthase}}
| + | |
− | {{#set: ec number=EC-2.3.3.9}} | + | |
− | {{#set: gene associated=Ec-12_003860}} | + | |
− | {{#set: in pathway=PWY-7295|PWY-7294|GLYOXDEG-PWY|P105-PWY|GLYOXYLATE-BYPASS|PWY-6969|PWY-6728|PWY-7118}} | + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |