Difference between revisions of "Ec-20 003790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Ec-20_003790 == * Synonym(s): ** Esi_0010_0069 ** Esi0010_0069 == Reactions associated == * Reaction: BADH-RXN ** Source: orthology-aragem =...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_003790 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0010_0069 |
− | ** | + | ** Esi0010_0069 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[BADH-RXN]] |
− | + | ** Source: [[orthology-aragem]] | |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[CHOLINE-BETAINE-ANA-PWY]] |
− | * [[ | + | * [[BETSYN-PWY]] |
− | + | * [[PWY-7494]] | |
− | * [[ | + | * [[PWY1F-353]] |
− | * [[ | + | * [[PWY-3722]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0010_0069|Esi0010_0069}} | |
− | + | {{#set: reaction associated=BADH-RXN}} | |
− | + | {{#set: pathway associated=CHOLINE-BETAINE-ANA-PWY|BETSYN-PWY|PWY-7494|PWY1F-353|PWY-3722}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:19, 21 March 2018
Gene Ec-20_003790
- Synonym(s):
- Esi_0010_0069
- Esi0010_0069
Reactions associated
- Reaction: BADH-RXN
- Source: orthology-aragem