Difference between revisions of "Ec-02 001850"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * smiles: ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
(Created page with "Category:Gene == Gene Ec-02_001850 == * Synonym(s): ** Esi_0055_0077 ** Esi0055_0077 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+
== Gene Ec-02_001850 ==
* smiles:
+
** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J
+
* common name:
+
** (2E)-5-methylhexa-2,4-dienoyl-CoA
+
* molecular weight:
+
** 871.642   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0055_0077
 +
** Esi0055_0077
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-11919]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0055_0077|Esi0055_0077}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176]
+
{{#set: reaction associated=RXN-8443}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5381}}
** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468]
+
{{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}}
+
{{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}}
+
{{#set: molecular weight=871.642    }}
+
{{#set: consumed by=RXN-11919}}
+

Latest revision as of 19:19, 21 March 2018

Gene Ec-02_001850

  • Synonym(s):
    • Esi_0055_0077
    • Esi0055_0077

Reactions associated

Pathways associated

External links