Difference between revisions of "Ec-01 001870"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Gene == Gene Ec-01_001870 == * left end position: ** 1578026 * transcription direction: ** NEGATIVE * right end position: ** 1588036 * centisome position: ** 15.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] ==
+
== Gene Ec-01_001870 ==
−
* smiles:
+
* left end position:
−
** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1578026
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** densipoloyl-CoA
+
** 1588036
−
* molecular weight:
+
* centisome position:
−
** 1041.936    
+
** 15.292677    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0112_0076
 +
** Esi0112_0076
 +
** ASS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ARGSUCCINSYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16150]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-10]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5154]]
 +
* [[PWY-5]]
 +
* [[ARGSYN-PWY]]
 +
* [[PWY-4984]]
 +
* [[ARGSYNBSUB-PWY]]
 +
* [[PWY-4983]]
 +
* [[PWY-7400]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1578026}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658551 90658551]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=1588036}}
−
{{#set: inchi key=InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J}}
+
{{#set: centisome position=15.292677    }}
−
{{#set: common name=densipoloyl-CoA}}
+
{{#set: common name=Esi_0112_0076|Esi0112_0076|ASS}}
−
{{#set: molecular weight=1041.936    }}
+
{{#set: reaction associated=ARGSUCCINSYN-RXN|RXN-10}}
−
{{#set: consumed or produced by=RXN-16150}}
+
{{#set: pathway associated=PWY-5154|PWY-5|ARGSYN-PWY|PWY-4984|ARGSYNBSUB-PWY|PWY-4983|PWY-7400}}

Latest revision as of 19:07, 21 March 2018

Gene Ec-01_001870

  • left end position:
    • 1578026
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1588036
  • centisome position:
    • 15.292677
  • Synonym(s):
    • Esi_0112_0076
    • Esi0112_0076
    • ASS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_001870&oldid=24739"