Difference between revisions of "Ec-01 006080"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Ec-01_006080 == * left end position: ** 5301428 * transcription direction: ** NEGATIVE * right end position: ** 5308041 * centisome position: ** 51.3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_006080 == |
− | * | + | * left end position: |
− | ** | + | ** 5301428 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5308041 |
− | * | + | * centisome position: |
− | ** | + | ** 51.37623 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0297_0005 |
− | ** | + | ** Esi0297_0005 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5301428}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5308041}} | |
− | + | {{#set: centisome position=51.37623 }} | |
− | + | {{#set: common name=Esi_0297_0005|Esi0297_0005}} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Gene Ec-01_006080
- left end position:
- 5301428
- transcription direction:
- NEGATIVE
- right end position:
- 5308041
- centisome position:
- 51.37623
- Synonym(s):
- Esi_0297_0005
- Esi0297_0005
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome