Difference between revisions of "LL-DIAMINOPIMELATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15056 CPD-15056] == * smiles: ** CC=C(N)C(=O)[O-] * inchi key: ** InChIKey=PAWSVPVNIXFKOS-I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] == * smiles: ** C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LL-DIAMINOPIMELATE LL-DIAMINOPIMELATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GMKMEZVLHJARHF-WHFBIAKZSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L,L-diaminopimelate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 190.199 |
* Synonym(s): | * Synonym(s): | ||
| + | ** L,L-A2pm | ||
| + | ** L,L-DAP | ||
| + | ** L,L-2,6-diaminopimelate | ||
| + | ** L,L-2,6-diaminoheptanedioate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-7737]] |
| + | * [[DIAMINOPIMEPIM-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 583-93-7 | ||
| + | * CAS : 14289-34-0 | ||
| + | * BIGG : 35647 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549100 1549100] |
| − | * | + | * HMDB : HMDB01370 |
| − | ** [http://www. | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00666 C00666] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57609 57609] |
| − | {{#set: smiles | + | * METABOLIGHTS : MTBLC57609 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=GMKMEZVLHJARHF-WHFBIAKZSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: common name=L,L-diaminopimelate}} |
| − | {{#set: | + | {{#set: molecular weight=190.199 }} |
| − | + | {{#set: common name=L,L-A2pm|L,L-DAP|L,L-2,6-diaminopimelate|L,L-2,6-diaminoheptanedioate}} | |
| − | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-7737|DIAMINOPIMEPIM-RXN}} |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite LL-DIAMINOPIMELATE
- smiles:
- C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O
- inchi key:
- InChIKey=GMKMEZVLHJARHF-WHFBIAKZSA-N
- common name:
- L,L-diaminopimelate
- molecular weight:
- 190.199
- Synonym(s):
- L,L-A2pm
- L,L-DAP
- L,L-2,6-diaminopimelate
- L,L-2,6-diaminoheptanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 583-93-7
- CAS : 14289-34-0
- BIGG : 35647
- PUBCHEM:
- HMDB : HMDB01370
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57609
"C(C(CCCC(C([O-])=O)[N+])[N+])([O-])=O" cannot be used as a page name in this wiki.
