Difference between revisions of "GLYCEROL-KIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-KIN-RXN GLYCEROL-KIN-RXN] == * direction: ** REVERSIBLE * common name: ** Carbohydrate kin...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-KIN-RXN GLYCEROL-KIN-RXN] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
+
 
* common name:
 
* common name:
−
** D-galactono-1,4-lactone
+
** Carbohydrate kinase, FGGY, C-terminal
−
* molecular weight:
+
* ec number:
−
** 178.141   
+
** [http://enzyme.expasy.org/EC/2.7.1.30 EC-2.7.1.30]
 
* Synonym(s):
 
* Synonym(s):
−
** D-galactonate-γ-lactone
 
−
** galactono-γ-lactone
 
−
** D-galactonolactone
 
−
** D-galactono-γ-lactone
 
−
** D-galactonic acid γ-lactone
 
−
** γ-D-galactonolactone
 
−
** D-(-)-galactonic acid γ-lactone
 
−
** D-galactonic acid g-lactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GALACTONOLACTONASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[GLYCEROL]][c] '''<=>''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 glycerol[c] '''<=>''' 1 sn-glycerol 3-phosphate[c] '''+''' 1 ADP[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_004370]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2782-07-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21644 21644]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165]
+
* LIGAND-RXN:
−
* HMDB : HMDB02541
+
** [http://www.genome.jp/dbget-bin/www_bget?R00847 R00847]
−
* LIGAND-CPD:
+
* UNIPROT:
−
** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383]
+
** [http://www.uniprot.org/uniprot/P18157 P18157]
−
* CHEMSPIDER:
+
** [http://www.uniprot.org/uniprot/P47284 P47284]
−
** [http://www.chemspider.com/Chemical-Structure.92162.html 92162]
+
** [http://www.uniprot.org/uniprot/Q9CG64 Q9CG64]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/Q9V207 Q9V207]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895]
+
** [http://www.uniprot.org/uniprot/P44400 P44400]
−
{{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}}
+
** [http://www.uniprot.org/uniprot/Q9WX53 Q9WX53]
−
{{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}}
+
** [http://www.uniprot.org/uniprot/Q7M0X5 Q7M0X5]
−
{{#set: common name=D-galactono-1,4-lactone}}
+
** [http://www.uniprot.org/uniprot/P0A6F3 P0A6F3]
−
{{#set: molecular weight=178.141    }}
+
** [http://www.uniprot.org/uniprot/P25013 P25013]
−
{{#set: common name=D-galactonate-&gamma;-lactone|galactono-&gamma;-lactone|D-galactonolactone|D-galactono-&gamma;-lactone|D-galactonic acid &gamma;-lactone|&gamma;-D-galactonolactone|D-(-)-galactonic acid &gamma;-lactone|D-galactonic acid g-lactone}}
+
** [http://www.uniprot.org/uniprot/P19255 P19255]
−
{{#set: consumed by=GALACTONOLACTONASE-RXN}}
+
** [http://www.uniprot.org/uniprot/P32190 P32190]
 +
** [http://www.uniprot.org/uniprot/P32189 P32189]
 +
** [http://www.uniprot.org/uniprot/P95907 P95907]
 +
** [http://www.uniprot.org/uniprot/Q49011 Q49011]
 +
** [http://www.uniprot.org/uniprot/O93623 O93623]
 +
{{#set: direction=REVERSIBLE}}
 +
{{#set: common name=Carbohydrate kinase, FGGY, C-terminal}}
 +
{{#set: ec number=EC-2.7.1.30}}
 +
{{#set: gene associated=Ec-21_004370}}
 +
{{#set: in pathway=PWY-4261}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:19, 21 March 2018

Reaction GLYCEROL-KIN-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • Carbohydrate kinase, FGGY, C-terminal
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 glycerol[c] <=> 1 sn-glycerol 3-phosphate[c] + 1 ADP[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-4261, glycerol degradation I: PWY-4261
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLYCEROL-KIN-RXN&oldid=26157"