Difference between revisions of "PWY-7049"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049] ==
* smiles:
+
* taxonomic range:
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=PGAVKCOVUIYSFO-XVFCMESISA-J
+
 
* common name:
 
* common name:
** UTP
+
** icosapentaenoate biosynthesis II (6-desaturase, mammals)
* molecular weight:
+
** 480.112   
+
 
* Synonym(s):
 
* Synonym(s):
** uridine-triphosphate
+
** eicosapentaenoic acid biosynthesis II
** uridine-5'-triphosphate
+
** eicosapentaenoate biosynthesis II (metazoa)
 +
** iicosapentaenoic acid biosynthesis II
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN0-724]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
* [[CTPSYN-RXN]]
+
* [[LINOLENOYL-RXN]]
* [[RXN-14139]]
+
** 4 associated gene(s):
* [[NAG1P-URIDYLTRANS-RXN]]
+
*** [[Ec-02_006430]]
* [[RXN-12199]]
+
*** [[Ec-12_008720]]
* [[RXN-14325]]
+
*** [[Ec-01_001560]]
== Reaction(s) known to produce the compound ==
+
*** [[Ec-03_003710]]
* [[UDPKIN-RXN]]
+
** 1 reconstruction source(s) associated:
== Reaction(s) of unknown directionality ==
+
*** [[annotation-esiliculosus_genome]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[RXN-13426]]
* [[RXN-12196]]
+
** 1 associated gene(s):
 +
*** [[Ec-24_002300]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13429 RXN-13429]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16019 RXN-16019]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16020 RXN-16020]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16021 RXN-16021]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16022 RXN-16022]
 
== External links  ==
 
== External links  ==
* CAS : 63-39-8
+
{{#set: taxonomic range=TAX-33208}}
* BIGG : 33760
+
{{#set: taxonomic range=TAX-4751}}
* PUBCHEM:
+
{{#set: common name=icosapentaenoate biosynthesis II (6-desaturase, mammals)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058168 7058168]
+
{{#set: common name=eicosapentaenoic acid biosynthesis II|eicosapentaenoate biosynthesis II (metazoa)|iicosapentaenoic acid biosynthesis II}}
* HMDB : HMDB00285
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=7}}
** [http://www.genome.jp/dbget-bin/www_bget?C00075 C00075]
+
{{#set: completion rate=29.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5414500.html 5414500]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=46398 46398]
+
* METABOLIGHTS : MTBLC46398
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))}}
+
{{#set: inchi key=InChIKey=PGAVKCOVUIYSFO-XVFCMESISA-J}}
+
{{#set: common name=UTP}}
+
{{#set: molecular weight=480.112    }}
+
{{#set: common name=uridine-triphosphate|uridine-5'-triphosphate}}
+
{{#set: consumed by=RXN0-724|CTPSYN-RXN|RXN-14139|NAG1P-URIDYLTRANS-RXN|RXN-12199|RXN-14325}}
+
{{#set: produced by=UDPKIN-RXN}}
+
{{#set: reversible reaction associated=GLUC1PURIDYLTRANS-RXN|RXN-12196}}
+

Latest revision as of 19:20, 21 March 2018

Pathway PWY-7049

  • taxonomic range:
  • common name:
    • icosapentaenoate biosynthesis II (6-desaturase, mammals)
  • Synonym(s):
    • eicosapentaenoic acid biosynthesis II
    • eicosapentaenoate biosynthesis II (metazoa)
    • iicosapentaenoic acid biosynthesis II

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links