Difference between revisions of "RXN-9531"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9531 RXN-9531] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-dodecanoyl-[acyl-carrie...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9531 RXN-9531] ==
−
* smiles:
+
* direction:
−
** CC(=O)C(O)C(O)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AJPADPZSRRUGHI-RFZPGFLSSA-L
+
 
* common name:
 
* common name:
−
** 1-deoxy-D-xylulose 5-phosphate
+
** 3-oxo-dodecanoyl-[acyl-carrier protein] synthase
−
* molecular weight:
+
** Beta-ketoacyl synthase, N-terminal
−
** 212.096   
+
** Thiolase-like, subgroup
 +
** beta-ketoacyl synthase, partial
 +
** 3-oxoacyl-[acyl-carrier-protein] synthase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** DXP
 
−
** deoxyxylulose-5-phosphate
 
−
** D-1-deoxyxylulose-5-P
 
−
** 1-deoxy-D-threo-pentulose 5-phosphate
 
−
** DOXP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DXS-RXN]]
+
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[Decanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-dodecanoyl-ACPs]][c] '''+''' 1 [[ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[DXPREDISOM-RXN]]
+
** 1 a malonyl-[acp][c] '''+''' 1 a decanoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 a 3-oxo-dodecanoyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_000640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-27_003480]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-27_002090]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-12_000650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''28''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23420274 23420274]
+
{{#set: common name=3-oxo-dodecanoyl-[acyl-carrier protein] synthase}}
−
* HMDB : HMDB01213
+
{{#set: common name=Beta-ketoacyl synthase, N-terminal}}
−
* LIGAND-CPD:
+
{{#set: common name=Thiolase-like, subgroup}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11437 C11437]
+
{{#set: common name=beta-ketoacyl synthase, partial}}
−
* CHEMSPIDER:
+
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}}
−
** [http://www.chemspider.com/Chemical-Structure.10462373.html 10462373]
+
{{#set: ec number=EC-2.3.1.41}}
−
* CHEBI:
+
{{#set: gene associated=Ec-12_000640|Ec-27_003480|Ec-27_002090|Ec-12_000650}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57792 57792]
+
{{#set: in pathway=PWY-5971}}
−
* BIGG : 216273
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=CC(=O)C(O)C(O)COP([O-])(=O)[O-]}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: inchi key=InChIKey=AJPADPZSRRUGHI-RFZPGFLSSA-L}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=1-deoxy-D-xylulose 5-phosphate}}
+
−
{{#set: molecular weight=212.096    }}
+
−
{{#set: common name=DXP|deoxyxylulose-5-phosphate|D-1-deoxyxylulose-5-P|1-deoxy-D-threo-pentulose 5-phosphate|DOXP}}
+
−
{{#set: produced by=DXS-RXN}}
+
−
{{#set: reversible reaction associated=DXPREDISOM-RXN}}
+

Latest revision as of 19:20, 21 March 2018

Reaction RXN-9531

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-dodecanoyl-[acyl-carrier protein] synthase
    • Beta-ketoacyl synthase, N-terminal
    • Thiolase-like, subgroup
    • beta-ketoacyl synthase, partial
    • 3-oxoacyl-[acyl-carrier-protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 28 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-dodecanoyl-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.


"3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9531&oldid=26211"