Difference between revisions of "PWY-5872"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-369 CPD-369] == * smiles: ** C(C(C(C(C(O)CO)O)O)O)O * inchi key: ** InChIKey=FBPFZTCFMRRESA...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5872 PWY-5872] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-369 CPD-369] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5872 PWY-5872] ==
* smiles:
+
* taxonomic range:
** C(C(C(C(C(O)CO)O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N
+
 
* common name:
 
* common name:
** L-iditol
+
** ubiquinol-10 biosynthesis (eukaryotic)
* molecular weight:
+
** 182.173   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Q10 biosynthesis
 +
** ubiquinone-10 biosynthesis (eukaryotic)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-9230]]
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
** 1 associated gene(s):
 +
*** [[Ec-00_007360]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9106 RXN-9106]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9234 RXN-9234]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9235 RXN-9235]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9236 RXN-9236]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9237 RXN-9237]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9279 RXN-9279]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9282 RXN-9282]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9285 RXN-9285]
 
== External links  ==
 
== External links  ==
* CAS : 488-45-9
+
{{#set: taxonomic range=TAX-2759}}
* PUBCHEM:
+
{{#set: common name=ubiquinol-10 biosynthesis (eukaryotic)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460044 5460044]
+
{{#set: common name=Q10 biosynthesis|ubiquinone-10 biosynthesis (eukaryotic)}}
* HMDB : HMDB11632
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=9}}
** [http://www.genome.jp/dbget-bin/www_bget?C01507 C01507]
+
{{#set: completion rate=11.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4573729.html 4573729]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18202 18202]
+
* METABOLIGHTS : MTBLC18202
+
{{#set: smiles=C(C(C(C(C(O)CO)O)O)O)O}}
+
{{#set: inchi key=InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N}}
+
{{#set: common name=L-iditol}}
+
{{#set: molecular weight=182.173    }}
+
{{#set: reversible reaction associated=L-IDITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:20, 21 March 2018

Pathway PWY-5872

  • taxonomic range:
  • common name:
    • ubiquinol-10 biosynthesis (eukaryotic)
  • Synonym(s):
    • Q10 biosynthesis
    • ubiquinone-10 biosynthesis (eukaryotic)

Reaction(s) found

1 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links