Difference between revisions of "Ec-24 003110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...")
(Created page with "Category:Gene == Gene Ec-24_003110 == * left end position: ** 3383362 * transcription direction: ** NEGATIVE * right end position: ** 3388656 * centisome position: ** 67.8...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
+
== Gene Ec-24_003110 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
+
** 3383362
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 1-18:1-2-lysophosphatidylethanolamine
+
** 3388656
−
* molecular weight:
+
* centisome position:
−
** 479.593    
+
** 67.83449    
 
* Synonym(s):
 
* Synonym(s):
−
** 1-18:1-lysoPE
+
** Esi_0034_0160
−
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
+
** Esi0034_0160
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15035]]
+
* Reaction: [[HYDROG-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-15067]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[RXN-15036]]
+
* [[PWY-6780]]
 +
* [[PWY4LZ-257]]
 +
* [[PWY-6785]]
 +
* [[PWY-6759]]
 +
* [[GLUDEG-II-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3383362}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=3388656}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
+
{{#set: centisome position=67.83449   }}
−
* HMDB : HMDB11506
+
{{#set: common name=Esi_0034_0160|Esi0034_0160}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
+
{{#set: reaction associated=HYDROG-RXN}}
−
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
+
{{#set: pathway associated=PWY-6780|PWY4LZ-257|PWY-6785|PWY-6759|GLUDEG-II-PWY}}
−
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
+
−
{{#set: molecular weight=479.593   }}
+
−
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: consumed by=RXN-15035}}
+
−
{{#set: produced by=RXN-15067}}
+
−
{{#set: reversible reaction associated=RXN-15036}}
+

Latest revision as of 20:20, 21 March 2018

Gene Ec-24_003110

  • left end position:
    • 3383362
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3388656
  • centisome position:
    • 67.83449
  • Synonym(s):
    • Esi_0034_0160
    • Esi0034_0160

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_003110&oldid=26261"