Difference between revisions of "Ec-03 000200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
(Created page with "Category:Gene == Gene Ec-03_000200 == * left end position: ** 253977 * transcription direction: ** NEGATIVE * right end position: ** 260590 * centisome position: ** 3.8901...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
+
== Gene Ec-03_000200 ==
−
* smiles:
+
* left end position:
−
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** 253977
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** gibberellin44 (open lactone form)
+
** 260590
−
* molecular weight:
+
* centisome position:
−
** 362.422    
+
** 3.890185    
 
* Synonym(s):
 
* Synonym(s):
−
** gibberellin A44 open lactone
+
** Esi_0027_0155
−
** gibberellin A44 diacid
+
** Esi0027_0155
−
** GA44 open lactone
+
** PK
−
** GA44 (open lactone form)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-168]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN1F-167]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170008
+
{{#set: left end position=253977}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
+
{{#set: right end position=260590}}
−
* CHEBI:
+
{{#set: centisome position=3.890185   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
+
{{#set: common name=Esi_0027_0155|Esi0027_0155|PK}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
+
−
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
+
−
{{#set: common name=gibberellin44 (open lactone form)}}
+
−
{{#set: molecular weight=362.422   }}
+
−
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
+
−
{{#set: consumed by=RXN1F-168}}
+
−
{{#set: produced by=RXN1F-167}}
+

Latest revision as of 19:21, 21 March 2018

Gene Ec-03_000200

  • left end position:
    • 253977
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 260590
  • centisome position:
    • 3.890185
  • Synonym(s):
    • Esi_0027_0155
    • Esi0027_0155
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_000200&oldid=26274"