Difference between revisions of "Ec-14 002880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
(Created page with "Category:Gene == Gene Ec-14_002880 == * left end position: ** 2716138 * transcription direction: ** NEGATIVE * right end position: ** 2719265 * centisome position: ** 41.4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
+
== Gene Ec-14_002880 ==
−
* smiles:
+
* left end position:
−
** C1(C(C(C(C(C1O)O)=O)O)O)O
+
** 2716138
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** scyllo-inosose
+
** 2719265
−
* molecular weight:
+
* centisome position:
−
** 178.141    
+
** 41.401844    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-keto-myo-inositol
+
** Esi_0089_0031
−
** 2,4,6/3,5-pentahydroxycyclohexanone
+
** Esi0089_0031
−
** 2-inosose
+
−
** 2-keto-scyllo-inositol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEROXID-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
*** Assignment: go-term
 +
* Reaction: [[RXN-14240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2716138}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2719265}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
+
{{#set: centisome position=41.401844   }}
−
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
+
{{#set: common name=Esi_0089_0031|Esi0089_0031}}
−
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
+
{{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
{{#set: common name=scyllo-inosose}}
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
{{#set: molecular weight=178.141   }}
+
−
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
+
−
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:21, 21 March 2018

Gene Ec-14_002880

  • left end position:
    • 2716138
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2719265
  • centisome position:
    • 41.401844
  • Synonym(s):
    • Esi_0089_0031
    • Esi0089_0031

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_002880&oldid=26293"