Difference between revisions of "ARGDEG-III-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGDEG-III-PWY ARGDEG-III-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGDEG-III-PWY ARGDEG-III-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
* inchi key:
+
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
** L-arginine degradation IV (arginine decarboxylase/agmatine deiminase pathway)
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-13]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[AGMATINE-DEIMINASE-RXN]]
* [[RXN66-12]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-02_001540]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_003010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ARGDECARBOX-RXN ARGDECARBOX-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1224}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203343 25203343]
+
{{#set: common name=L-arginine degradation IV (arginine decarboxylase/agmatine deiminase pathway)}}
* HMDB : HMDB12159
+
{{#set: reaction found=2}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: total reaction=3}}
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: completion rate=67.0}}
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=442.724    }}
+
{{#set: consumed by=RXN66-13}}
+
{{#set: produced by=RXN66-12}}
+

Latest revision as of 19:21, 21 March 2018

Pathway ARGDEG-III-PWY

  • taxonomic range:
  • common name:
    • L-arginine degradation IV (arginine decarboxylase/agmatine deiminase pathway)
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links