Difference between revisions of "P321-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P321-PWY P321-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P321-PWY P321-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** benzoyl-CoA degradation III (anaerobic) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** anaerobic benzoyl-CoA degradation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''9''' reactions in the full pathway |
− | == Reaction(s) | + | * [[RXN-8032]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | == | + | *** [[Ec-25_001550]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.259-RXN 1.1.1.259-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.62-RXN 1.3.1.62-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.15-RXN 1.3.99.15-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R265-RXN R265-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R266-RXN R266-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R267-RXN R267-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R268-RXN R268-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8031 RXN-8031] | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-PWY : benz |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=benzoyl-CoA degradation III (anaerobic)}} | |
− | + | {{#set: common name=anaerobic benzoyl-CoA degradation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=11.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:21, 21 March 2018
Pathway P321-PWY
- taxonomic range:
- common name:
- benzoyl-CoA degradation III (anaerobic)
- Synonym(s):
- anaerobic benzoyl-CoA degradation
Reaction(s) found
1 reactions found over 9 reactions in the full pathway
- RXN-8032
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : benz