Difference between revisions of "CPD-10332"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-DIOXYGENASE-RXN CYSTEINE-DIOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-DIOXYGENASE-RXN CYSTEINE-DIOXYGENASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
 
* common name:
 
* common name:
−
** cysteine dioxygenase
+
** gibberellin44 (open lactone form)
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.13.11.20 EC-1.13.11.20]
+
** 362.422   
 
* Synonym(s):
 
* Synonym(s):
 +
** gibberellin A44 open lactone
 +
** gibberellin A44 diacid
 +
** GA44 open lactone
 +
** GA44 (open lactone form)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1F-168]]
−
** 1 [[CYS]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[3-SULFINOALANINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN1F-167]]
−
** 1 L-cysteine[c] '''+''' 1 oxygen[c] '''=>''' 1 H+[c] '''+''' 1 3-sulfinoalanine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-18_002940]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-5331]], taurine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5331 PWY-5331]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[CYSTEINE-DEG-PWY]], L-cysteine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-DEG-PWY CYSTEINE-DEG-PWY]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* LIPID_MAPS : LMPR0104170008
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20441 20441]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00893 R00893]
+
* CHEBI:
−
* UNIPROT:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
−
** [http://www.uniprot.org/uniprot/P21816 P21816]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q16878 Q16878]
+
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
−
{{#set: common name=cysteine dioxygenase}}
+
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
−
{{#set: ec number=EC-1.13.11.20}}
+
{{#set: common name=gibberellin44 (open lactone form)}}
−
{{#set: gene associated=Ec-18_002940}}
+
{{#set: molecular weight=362.422    }}
−
{{#set: in pathway=PWY-5331|CYSTEINE-DEG-PWY}}
+
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN1F-168}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: produced by=RXN1F-167}}
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-10332

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
  • common name:
    • gibberellin44 (open lactone form)
  • molecular weight:
    • 362.422
  • Synonym(s):
    • gibberellin A44 open lactone
    • gibberellin A44 diacid
    • GA44 open lactone
    • GA44 (open lactone form)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-10332&oldid=26343"