Difference between revisions of "PWY-6269"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** adenosylcobalamin salvage from cobinamide II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** vitamin B12 biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[BTUR2-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
− | * [ | + | *** [[Ec-06_010830]] |
− | * [ | + | ** 1 reconstruction source(s) associated: |
− | * [ | + | *** [[annotation-esiliculosus_genome]] |
− | * [ | + | == Reaction(s) not found == |
+ | * [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R346-RXN R346-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8770 RXN-8770] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=adenosylcobalamin salvage from cobinamide II}} | |
− | + | {{#set: common name=vitamin B12 biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=14.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:21, 21 March 2018
Pathway PWY-6269
- taxonomic range:
- common name:
- adenosylcobalamin salvage from cobinamide II
- Synonym(s):
- vitamin B12 biosynthesis
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- BTUR2-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: