Difference between revisions of "CPD-14808"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-21_005540 == * left end position: ** 6457142 * transcription direction: ** NEGATIVE * right end position: ** 6465819 * centisome position: ** 87.4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-21_005540 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
* left end position:
+
* smiles:
** 6457142
+
** C1(C(C(C(C(C1O)O)=O)O)O)O
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
* right end position:
+
* common name:
** 6465819
+
** scyllo-inosose
* centisome position:
+
* molecular weight:
** 87.49374    
+
** 178.141    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0014_0051
+
** 2-keto-myo-inositol
** Esi0014_0051
+
** 2,4,6/3,5-pentahydroxycyclohexanone
** CYN
+
** 2-inosose
 +
** 2-keto-scyllo-inositol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** esiliculosus_genome
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=6457142}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
{{#set: right end position=6465819}}
+
* CHEBI:
{{#set: centisome position=87.49374   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
{{#set: common name=Esi_0014_0051|Esi0014_0051|CYN}}
+
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
 +
{{#set: common name=scyllo-inosose}}
 +
{{#set: molecular weight=178.141   }}
 +
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
 +
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}

Latest revision as of 19:21, 21 March 2018

Metabolite CPD-14808

  • smiles:
    • C1(C(C(C(C(C1O)O)=O)O)O)O
  • inchi key:
    • InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
  • common name:
    • scyllo-inosose
  • molecular weight:
    • 178.141
  • Synonym(s):
    • 2-keto-myo-inositol
    • 2,4,6/3,5-pentahydroxycyclohexanone
    • 2-inosose
    • 2-keto-scyllo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links