Difference between revisions of "4-GUANIDO-BUTYRAMIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-19_003370 == * left end position: ** 3632531 * transcription direction: ** POSITIVE * right end position: ** 3636584 * centisome position: ** 60.8...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == * smiles: ** C(NC(N)=[N+])CCC(=O)N * inchi key: *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-19_003370 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] ==
−
* left end position:
+
* smiles:
−
** 3632531
+
** C(NC(N)=[N+])CCC(=O)N
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
−
* right end position:
+
* common name:
−
** 3636584
+
** 4-guanidinobutyramide
−
* centisome position:
+
* molecular weight:
−
** 60.8394    
+
** 145.184    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0402_0019
+
** 4-guanidinobutanamide
−
** Esi0402_0019
+
** 4-guanidobutanamide
−
** Pdi6
+
** 4-guanido-butyramide
 +
** γ-guanidinobutyramide
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[5.3.4.1-RXN]]
+
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[ARGININE-2-MONOOXYGENASE-RXN]]
−
* [[DISULISOM-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3632531}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936]
−
{{#set: right end position=3636584}}
+
* CHEBI:
−
{{#set: centisome position=60.8394   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365]
−
{{#set: common name=Esi_0402_0019|Esi0402_0019|Pdi6}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078]
 +
{{#set: smiles=C(NC(N)=[N+])CCC(=O)N}}
 +
{{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}}
 +
{{#set: common name=4-guanidinobutyramide}}
 +
{{#set: molecular weight=145.184   }}
 +
{{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}}
 +
{{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}}
 +
{{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}}

Latest revision as of 19:21, 21 March 2018

Metabolite 4-GUANIDO-BUTYRAMIDE

  • smiles:
    • C(NC(N)=[N+])CCC(=O)N
  • inchi key:
    • InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
  • common name:
    • 4-guanidinobutyramide
  • molecular weight:
    • 145.184
  • Synonym(s):
    • 4-guanidinobutanamide
    • 4-guanidobutanamide
    • 4-guanido-butyramide
    • γ-guanidinobutyramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC(N)=[N+])CCC(=O)N" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=4-GUANIDO-BUTYRAMIDE&oldid=26384"