Difference between revisions of "Ec-07 003680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Ec-07_003680 == * left end position: ** 3727476 * transcription direction: ** POSITIVE * right end position: ** 3738628 * centisome position: ** 48.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] ==
+
== Gene Ec-07_003680 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])CC(=N)C(=O)[O-]
+
** 3727476
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-iminosuccinate
+
** 3738628
−
* molecular weight:
+
* centisome position:
−
** 129.072    
+
** 48.268173    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-iminobutanedioate
+
** Esi_0046_0098
−
** α-iminosuccinate
+
** Esi0046_0098
−
** iminoaspartate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[QUINOLINATE-SYNTHA-RXN]]
+
* Reaction: [[ADENYL-KIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[L-ASPARTATE-OXID-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-11832]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12002]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7913]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 +
* [[PWY-7205]]
 +
* [[PWY-7197]]
 +
* [[PWY-7176]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3727476}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615393 23615393]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB01131
+
{{#set: right end position=3738628}}
−
* LIGAND-CPD:
+
{{#set: centisome position=48.268173   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05840 C05840]
+
{{#set: common name=Esi_0046_0098|Esi0046_0098}}
−
* CHEMSPIDER:
+
{{#set: reaction associated=ADENYL-KIN-RXN|RXN-11832|RXN-12002|RXN-7913}}
−
** [http://www.chemspider.com/Chemical-Structure.19951415.html 19951415]
+
{{#set: pathway associated=PWY-7219|PWY-7205|PWY-7197|PWY-7176}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58831 58831]
+
−
* BIGG : 46611
+
−
{{#set: smiles=C(=O)([O-])CC(=N)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L}}
+
−
{{#set: common name=2-iminosuccinate}}
+
−
{{#set: molecular weight=129.072   }}
+
−
{{#set: common name=2-iminobutanedioate|α-iminosuccinate|iminoaspartate}}
+
−
{{#set: consumed by=QUINOLINATE-SYNTHA-RXN}}
+
−
{{#set: produced by=L-ASPARTATE-OXID-RXN}}
+

Latest revision as of 19:22, 21 March 2018

Gene Ec-07_003680

  • left end position:
    • 3727476
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3738628
  • centisome position:
    • 48.268173
  • Synonym(s):
    • Esi_0046_0098
    • Esi0046_0098

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_003680&oldid=26412"