Difference between revisions of "RXN-14117"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14117 RXN-14117] == * direction: ** REVERSIBLE * common name: ** Pyruvate kinase, alpha/beta **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14117 RXN-14117] ==
−
* smiles:
+
* direction:
−
** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J
+
 
* common name:
 
* common name:
−
** dATP
+
** Pyruvate kinase, alpha/beta
−
* molecular weight:
+
** pyruvate kinase
−
** 487.152   
+
** Pyruvate kinase, barrel
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.1.40 EC-2.7.1.40]
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxyATP
 
−
** 2'-deoxyadenosine triphosphate
 
−
** deoxy-ATP
 
−
** deoxyadenosine-triphosphate
 
−
** 2'-deoxyadenosine-5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14195]]
+
* With identifiers:
−
* [[RXN-14214]]
+
** 1 [[GTP]][c] '''+''' 1 [[PYRUVATE]][c] '''<=>''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c]
−
* [[RXN-14290]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 GTP[c] '''+''' 1 pyruvate[c] '''<=>''' 1 phosphoenolpyruvate[c] '''+''' 1 GDP[c] '''+''' 1 H+[c]
−
* [[DADPKIN-RXN]]
+
 
−
* [[RXN0-745]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-14192]]
+
* Gene: [[Ec-06_006860]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-12_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_004170]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1927-31-7
+
* RHEA:
−
* BIGG : 33969
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30298 30298]
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25320183 25320183]
+
{{#set: common name=Pyruvate kinase, alpha/beta}}
−
* HMDB : HMDB01532
+
{{#set: common name=pyruvate kinase}}
−
* LIGAND-CPD:
+
{{#set: common name=Pyruvate kinase, barrel}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00131 C00131]
+
{{#set: ec number=EC-2.7.1.40}}
−
* CHEBI:
+
{{#set: gene associated=Ec-06_006860|Ec-12_000950|Ec-26_004170}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61404 61404]
+
{{#set: in pathway=}}
−
* METABOLIGHTS : MTBLC61404
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=SUYVUBYJARFZHO-RRKCRQDMSA-J}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=dATP}}
+
−
{{#set: molecular weight=487.152    }}
+
−
{{#set: common name=2'-deoxyATP|2'-deoxyadenosine triphosphate|deoxy-ATP|deoxyadenosine-triphosphate|2'-deoxyadenosine-5'-triphosphate}}
+
−
{{#set: consumed by=RXN-14195|RXN-14214|RXN-14290}}
+
−
{{#set: produced by=DADPKIN-RXN|RXN0-745}}
+
−
{{#set: reversible reaction associated=RXN-14192}}
+

Latest revision as of 19:22, 21 March 2018

Reaction RXN-14117

  • direction:
    • REVERSIBLE
  • common name:
    • Pyruvate kinase, alpha/beta
    • pyruvate kinase
    • Pyruvate kinase, barrel
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14117&oldid=26457"