Difference between revisions of "RXN-13482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17332 CPD-17332] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] == * direction: ** REVERSIBLE * common name: ** Aspartate/ornithine carbamoylt...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17332 CPD-17332] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=UQPANOGFYCZRAV-AFQBPCMKSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-tetracosapentaenoyl-CoA
+
** Aspartate/ornithine carbamoyltransferase
−
* molecular weight:
+
* ec number:
−
** 1118.034   
+
** [http://enzyme.expasy.org/EC/2.1.3.3 EC-2.1.3.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA
 
−
** 3-oxo-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA
 
−
** 3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16129]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CARBAMOYL-P]][c] '''+''' 1 [[L-ORNITHINE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[L-CITRULLINE]][c] '''+''' 1 [[Pi]][c]
−
* [[RXN-16082]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 carbamoyl phosphate[c] '''+''' 1 L-ornithine[c] '''<=>''' 1 H+[c] '''+''' 1 L-citrulline[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_004630]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581129 71581129]
+
{{#set: common name=Aspartate/ornithine carbamoyltransferase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.1.3.3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73871 73871]
+
{{#set: gene associated=Ec-00_004630}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=UQPANOGFYCZRAV-AFQBPCMKSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=3-oxo-tetracosapentaenoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=1118.034    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA|3-oxo-all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA|3-oxo-(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16129}}
+
−
{{#set: produced by=RXN-16082}}
+

Latest revision as of 19:23, 21 March 2018

Reaction RXN-13482

  • direction:
    • REVERSIBLE
  • common name:
    • Aspartate/ornithine carbamoyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 carbamoyl phosphate[c] + 1 L-ornithine[c] <=> 1 H+[c] + 1 L-citrulline[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13482&oldid=26503"