Difference between revisions of "PWY-6803"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * smiles: ** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6803 PWY-6803] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6803 PWY-6803] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
−
* inchi key:
+
−
** InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
+
 
* common name:
 
* common name:
−
** deacetylmycothiol
+
** phosphatidylcholine acyl editing
−
* molecular weight:
+
−
** 445.461   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
 
−
** Cys-GlcN-Ins
 
−
** 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
 
−
** desacetylmycothiol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''4''' reactions in the full pathway
−
* [[RXN1G-121]]
+
* [[2.3.1.23-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-16_002160]]
 +
*** [[Ec-27_004770]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PHOSPHOLIPASE-A1-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7904]]
 +
** 4 associated gene(s):
 +
*** [[Ec-02_006430]]
 +
*** [[Ec-12_008720]]
 +
*** [[Ec-03_003710]]
 +
*** [[Ec-01_001560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOLIPASE-A2-RXN PHOSPHOLIPASE-A2-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-58024}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878469 46878469]
+
{{#set: common name=phosphatidylcholine acyl editing}}
−
* CHEBI:
+
{{#set: reaction found=3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58887 58887]
+
{{#set: total reaction=4}}
−
{{#set: smiles=C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}}
+
{{#set: completion rate=75.0}}
−
{{#set: inchi key=InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O}}
+
−
{{#set: common name=deacetylmycothiol}}
+
−
{{#set: molecular weight=445.461    }}
+
−
{{#set: common name=1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside|Cys-GlcN-Ins|3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol|desacetylmycothiol}}
+
−
{{#set: produced by=RXN1G-121}}
+

Latest revision as of 20:23, 21 March 2018

Pathway PWY-6803

  • taxonomic range:
  • common name:
    • phosphatidylcholine acyl editing
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6803&oldid=26564"