Difference between revisions of "PWY-6470"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6470 PWY-6470] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6470 PWY-6470] ==
−
* smiles:
+
* taxonomic range:
−
** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
** InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M
+
 
* common name:
 
* common name:
−
** 3-dehydroshikimate
+
** peptidoglycan biosynthesis V (β-lactam resistance)
−
* molecular weight:
+
−
** 171.129   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-dehydroshikimic acid
+
** penicillin resistance
−
** 5-dehydroshikimic acid
+
** β-lactam resistance
−
** 5-dehydroshikimate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
'''2''' reactions found over '''11''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[PWY-6386]]
−
* [[RXN-7968]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-11347]]
−
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
** 1 associated gene(s):
 +
*** [[Ec-07_007020]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.4.17.14-RXN 3.4.17.14-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11343 RXN-11343]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11344 RXN-11344]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11345 RXN-11345]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11346 RXN-11346]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11348 RXN-11348]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11349 RXN-11349]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15521 RXN-15521]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-201174}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460360 5460360]
+
{{#set: taxonomic range=TAX-1239}}
−
* CHEMSPIDER:
+
{{#set: common name=peptidoglycan biosynthesis V (β-lactam resistance)}}
−
** [http://www.chemspider.com/Chemical-Structure.4573915.html 4573915]
+
{{#set: common name=penicillin resistance|β-lactam resistance}}
−
* CHEBI:
+
{{#set: reaction found=2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16630 16630]
+
{{#set: total reaction=11}}
−
* BIGG : 40260
+
{{#set: completion rate=18.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02637 C02637]
+
−
{{#set: smiles=C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)}}
+
−
{{#set: inchi key=InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M}}
+
−
{{#set: common name=3-dehydroshikimate}}
+
−
{{#set: molecular weight=171.129    }}
+
−
{{#set: common name=3-dehydroshikimic acid|5-dehydroshikimic acid|5-dehydroshikimate}}
+
−
{{#set: consumed by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
+
−
{{#set: produced by=RXN-7968}}
+
−
{{#set: reversible reaction associated=3-DEHYDROQUINATE-DEHYDRATASE-RXN}}
+

Latest revision as of 19:23, 21 March 2018

Pathway PWY-6470

  • taxonomic range:
  • common name:
    • peptidoglycan biosynthesis V (β-lactam resistance)
  • Synonym(s):
    • penicillin resistance
    • β-lactam resistance

Reaction(s) found

2 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6470&oldid=26577"