Difference between revisions of "CPD1G-120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-04_004710 == * left end position: ** 4759090 * transcription direction: ** NEGATIVE * right end position: ** 4766519 * centisome position: ** 73.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * smiles: ** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-04_004710 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] ==
−
* left end position:
+
* smiles:
−
** 4759090
+
** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
−
* right end position:
+
* common name:
−
** 4766519
+
** deacetylmycothiol
−
* centisome position:
+
* molecular weight:
−
** 73.08352    
+
** 445.461    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0037_0138
+
** 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
−
** Esi0037_0138
+
** Cys-GlcN-Ins
−
** FBP
+
** 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
 +
** desacetylmycothiol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[F16BDEPHOS-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN1G-121]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[aragem]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
+
−
** [[pantograph]]-[[aragem]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways associated ==
+
−
* [[GLYCOLYSIS]]
+
−
* [[SUCSYN-PWY]]
+
−
* [[CALVIN-PWY]]
+
−
* [[GLUCONEO-PWY]]
+
−
* [[PWY-5484]]
+
−
* [[P185-PWY]]
+
−
* [[PWY66-399]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4759090}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878469 46878469]
−
{{#set: right end position=4766519}}
+
* CHEBI:
−
{{#set: centisome position=73.08352   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58887 58887]
−
{{#set: common name=Esi_0037_0138|Esi0037_0138|FBP}}
+
{{#set: smiles=C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}}
−
{{#set: reaction associated=F16BDEPHOS-RXN|SEDOHEPTULOSE-BISPHOSPHATASE-RXN}}
+
{{#set: inchi key=InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O}}
−
{{#set: pathway associated=GLYCOLYSIS|SUCSYN-PWY|CALVIN-PWY|GLUCONEO-PWY|PWY-5484|P185-PWY|PWY66-399}}
+
{{#set: common name=deacetylmycothiol}}
 +
{{#set: molecular weight=445.461   }}
 +
{{#set: common name=1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside|Cys-GlcN-Ins|3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol|desacetylmycothiol}}
 +
{{#set: produced by=RXN1G-121}}

Latest revision as of 19:23, 21 March 2018

Metabolite CPD1G-120

  • smiles:
    • C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
  • inchi key:
    • InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
  • common name:
    • deacetylmycothiol
  • molecular weight:
    • 445.461
  • Synonym(s):
    • 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
    • Cys-GlcN-Ins
    • 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
    • desacetylmycothiol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1G-120&oldid=26608"