Difference between revisions of "MAP-Kinase-L-Tyr"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SORBITOL SORBITOL] == * smiles: ** C(C(C(C(C(CO)O)O)O)O)O * inchi key: ** InChIKey=FBPFZTCFMRRE...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Tyr MAP-Kinase-L-Tyr] == * common name: ** a [mitogen-activated protein kinase]-L-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SORBITOL SORBITOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAP-Kinase-L-Tyr MAP-Kinase-L-Tyr] ==
* smiles:
+
** C(C(C(C(C(CO)O)O)O)O)O
+
* inchi key:
+
** InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N
+
 
* common name:
 
* common name:
** D-sorbitol
+
** a [mitogen-activated protein kinase]-L-tyrosine
* molecular weight:
+
** 182.173   
+
 
* Synonym(s):
 
* Synonym(s):
** L-gulitol
 
** D-glucitol
 
** meglumine
 
** iso-sorbide
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-7644]]
+
* [[RXN-16317]]
 
== External links  ==
 
== External links  ==
* CAS : 50-70-4
+
{{#set: common name=a [mitogen-activated protein kinase]-L-tyrosine}}
* BIGG : 36018
+
{{#set: reversible reaction associated=RXN-16317}}
* DRUGBANK : DB01638
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5780 5780]
+
* HMDB : HMDB00247
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00794 C00794]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5576.html 5576]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17924 17924]
+
* METABOLIGHTS : MTBLC17924
+
{{#set: smiles=C(C(C(C(C(CO)O)O)O)O)O}}
+
{{#set: inchi key=InChIKey=FBPFZTCFMRRESA-JGWLITMVSA-N}}
+
{{#set: common name=D-sorbitol}}
+
{{#set: molecular weight=182.173    }}
+
{{#set: common name=L-gulitol|D-glucitol|meglumine|iso-sorbide}}
+
{{#set: reversible reaction associated=RXN-7644}}
+

Latest revision as of 19:23, 21 March 2018

Metabolite MAP-Kinase-L-Tyr

  • common name:
    • a [mitogen-activated protein kinase]-L-tyrosine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [mitogen-activated protein kinase]-L-tyrosine" cannot be used as a page name in this wiki.