Difference between revisions of "3-DEHYDRO-SHIKIMATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == * smiles: ** CC(C(O)(CC(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M |
* common name: | * common name: | ||
− | ** | + | ** 3-dehydroshikimate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 171.129 |
* Synonym(s): | * Synonym(s): | ||
− | ** 3- | + | ** 3-dehydroshikimic acid |
− | ** | + | ** 5-dehydroshikimic acid |
− | + | ** 5-dehydroshikimate | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7968]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[3- | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
− | + | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460360 5460360] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4573915.html 4573915] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16630 16630] |
− | * BIGG : | + | * BIGG : 40260 |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02637 C02637] |
− | {{#set: common name= | + | {{#set: smiles=C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M}} |
− | {{#set: common name=3- | + | {{#set: common name=3-dehydroshikimate}} |
− | {{#set: produced by= | + | {{#set: molecular weight=171.129 }} |
− | {{#set: reversible reaction associated=3- | + | {{#set: common name=3-dehydroshikimic acid|5-dehydroshikimic acid|5-dehydroshikimate}} |
+ | {{#set: consumed by=SHIKIMATE-5-DEHYDROGENASE-RXN}} | ||
+ | {{#set: produced by=RXN-7968}} | ||
+ | {{#set: reversible reaction associated=3-DEHYDROQUINATE-DEHYDRATASE-RXN}} |
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite 3-DEHYDRO-SHIKIMATE
- smiles:
- C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)
- inchi key:
- InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M
- common name:
- 3-dehydroshikimate
- molecular weight:
- 171.129
- Synonym(s):
- 3-dehydroshikimic acid
- 5-dehydroshikimic acid
- 5-dehydroshikimate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)" cannot be used as a page name in this wiki.