Difference between revisions of "PWY-7626"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLIN SCOPOLIN] == * smiles: ** COC2(=CC1(=C(OC(C=C1)=O)C=C2OC3(C(C(C(O)C(CO)O3)O)O))) * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7626 PWY-7626] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7626 PWY-7626] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** bacilysin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''10''' reactions in the full pathway |
− | == Reaction(s) | + | * [[CHORISMATEMUT-RXN]] |
− | == | + | ** 2 associated gene(s): |
+ | *** [[Ec-01_007700]] | ||
+ | *** [[Ec-27_003130]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16263 RXN-16263] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16264 RXN-16264] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16265 RXN-16265] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16285 RXN-16285] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16296 RXN-16296] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16297 RXN-16297] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16298 RXN-16298] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16299 RXN-16299] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16300 RXN-16300] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=bacilysin biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=10.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:24, 21 March 2018
Pathway PWY-7626
- taxonomic range:
- common name:
- bacilysin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 10 reactions in the full pathway
- CHORISMATEMUT-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: