Difference between revisions of "Ec-07 002990"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * inchi ke...")
(Created page with "Category:Gene == Gene Ec-07_002990 == * left end position: ** 3210217 * transcription direction: ** NEGATIVE * right end position: ** 3216018 * centisome position: ** 41.5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] ==
+
== Gene Ec-07_002990 ==
−
* smiles:
+
* left end position:
−
** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)
+
** 3210217
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** isochorismate
+
** 3216018
−
* molecular weight:
+
* centisome position:
−
** 224.17    
+
** 41.570038    
 
* Synonym(s):
 
* Synonym(s):
−
** Isochorismic acid
+
** Esi_0327_0010
 +
** Esi0327_0010
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-1061]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[ISOCHORSYN-RXN]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 22642-82-6
+
{{#set: left end position=3210217}}
−
* DRUGBANK : DB02793
+
{{#set: transcription direction=NEGATIVE}}
−
* PUBCHEM:
+
{{#set: right end position=3216018}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460580 5460580]
+
{{#set: centisome position=41.570038   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0327_0010|Esi0327_0010}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00885 C00885]
+
{{#set: reaction associated=RXN0-1061}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4574080.html 4574080]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29780 29780]
+
−
* BIGG : 36293
+
−
{{#set: smiles=C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L}}
+
−
{{#set: common name=isochorismate}}
+
−
{{#set: molecular weight=224.17   }}
+
−
{{#set: common name=Isochorismic acid}}
+
−
{{#set: reversible reaction associated=ISOCHORSYN-RXN}}
+

Latest revision as of 19:24, 21 March 2018

Gene Ec-07_002990

  • left end position:
    • 3210217
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3216018
  • centisome position:
    • 41.570038
  • Synonym(s):
    • Esi_0327_0010
    • Esi0327_0010

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_002990&oldid=26671"