Difference between revisions of "GDPKIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL PYRIDOXAL] == * smiles: ** CC1(N=CC(=C(C=1O)C=O)CO) * inchi key: ** InChIKey=RADKZDMF...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPKIN-RXN GDPKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** nucleoside diphosphate ki...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAL PYRIDOXAL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPKIN-RXN GDPKIN-RXN] ==
−
* smiles:
+
* direction:
−
** CC1(N=CC(=C(C=1O)C=O)CO)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RADKZDMFGJYCBB-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** pyridoxal
+
** nucleoside diphosphate kinase
−
* molecular weight:
+
** Nucleoside diphosphate kinase
−
** 167.164   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.4.6 EC-2.7.4.6]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PYRIDOXKIN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GDP]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[GTP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 GDP[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 GTP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_005170]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-03_001380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-22_003280]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_004330]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-26_003930]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-07_000140]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-04_001140]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-7221]], guanosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7221 PWY-7221]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
* [[PPGPPMET-PWY]], ppGpp biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PPGPPMET-PWY PPGPPMET-PWY]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 66-72-8
+
* RHEA:
−
* BIGG : 34393
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27686 27686]
−
* DRUGBANK : DB00147
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00330 R00330]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1050 1050]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB01545
+
{{#set: common name=nucleoside diphosphate kinase}}
−
* LIGAND-CPD:
+
{{#set: common name=Nucleoside diphosphate kinase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00250 C00250]
+
{{#set: ec number=EC-2.7.4.6}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Ec-11_005170|Ec-03_001380|Ec-22_003280|Ec-11_004330|Ec-26_003930|Ec-07_000140|Ec-04_001140}}
−
** [http://www.chemspider.com/Chemical-Structure.1021.html 1021]
+
{{#set: in pathway=PWY-7221|PPGPPMET-PWY}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17310 17310]
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
* METABOLIGHTS : MTBLC17310
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=CC1(N=CC(=C(C=1O)C=O)CO)}}
+
−
{{#set: inchi key=InChIKey=RADKZDMFGJYCBB-UHFFFAOYSA-N}}
+
−
{{#set: common name=pyridoxal}}
+
−
{{#set: molecular weight=167.164    }}
+
−
{{#set: consumed by=PYRIDOXKIN-RXN}}
+

Latest revision as of 19:08, 21 March 2018

Reaction GDPKIN-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nucleoside diphosphate kinase
    • Nucleoside diphosphate kinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 GDP[c] + 1 ATP[c] => 1 ADP[c] + 1 GTP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7221, guanosine ribonucleotides de novo biosynthesis: PWY-7221
    • 4 reactions found over 4 reactions in the full pathway
  • PPGPPMET-PWY, ppGpp biosynthesis: PPGPPMET-PWY
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GDPKIN-RXN&oldid=24795"