Difference between revisions of "Ec-09 001710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] == * smiles: ** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Gene == Gene Ec-09_001710 == * left end position: ** 2038138 * transcription direction: ** POSITIVE * right end position: ** 2043093 * centisome position: ** 36.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] ==
+
== Gene Ec-09_001710 ==
−
* smiles:
+
* left end position:
−
** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
** 2038138
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 24-hydroxy-3-oxocholest-4-en-26-oyl-CoA
+
** 2043093
−
* molecular weight:
+
* centisome position:
−
** 1176.114    
+
** 36.309986    
 
* Synonym(s):
 
* Synonym(s):
−
** cholest-4-en-24-ol-3-one-26-oyl-CoA
+
** Esi_0074_0004
 +
** Esi0074_0004
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12705]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2038138}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658714 90658714]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: right end position=2043093}}
−
{{#set: inchi key=InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J}}
+
{{#set: centisome position=36.309986   }}
−
{{#set: common name=24-hydroxy-3-oxocholest-4-en-26-oyl-CoA}}
+
{{#set: common name=Esi_0074_0004|Esi0074_0004}}
−
{{#set: molecular weight=1176.114   }}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: common name=cholest-4-en-24-ol-3-one-26-oyl-CoA}}
+
−
{{#set: consumed by=RXN-12705}}
+

Latest revision as of 19:25, 21 March 2018

Gene Ec-09_001710

  • left end position:
    • 2038138
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2043093
  • centisome position:
    • 36.309986
  • Synonym(s):
    • Esi_0074_0004
    • Esi0074_0004

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_001710&oldid=26763"