Difference between revisions of "Sulfhydryls"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] == * common name: ** R'C(R)SH * Synonym(s): ** a sulfhydryls == React...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfhydryls Sulfhydryls] ==
* smiles:
+
** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
* inchi key:
+
** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
+
 
* common name:
 
* common name:
** (5Z)-tetradecenoyl-CoA
+
** R'C(R)SH
* molecular weight:
+
** 971.845   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-tetradec-5-enoyl-CoA
+
** a sulfhydryls
** 14:1 cis-5
+
** 14:1(n-9)
+
** (5Z)-tetradec-5-enoyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14576]]
+
* [[THIOL-OXIDASE-RXN]]
* [[RXN-17783]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=R'C(R)SH}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071]
+
{{#set: common name=a sulfhydryls}}
* CHEBI:
+
{{#set: consumed by=THIOL-OXIDASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650]
+
{{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}}
+
{{#set: common name=(5Z)-tetradecenoyl-CoA}}
+
{{#set: molecular weight=971.845    }}
+
{{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}}
+
{{#set: consumed by=RXN-14576|RXN-17783}}
+

Latest revision as of 19:25, 21 March 2018

Metabolite Sulfhydryls

  • common name:
    • R'C(R)SH
  • Synonym(s):
    • a sulfhydryls

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links