Difference between revisions of "Charged-SER-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-SER-tRNAs Charged-SER-tRNAs] == * common name: ** an L-seryl-[tRNAser] * Synonym(s): **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-SER-tRNAs Charged-SER-tRNAs] ==
* smiles:
+
** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
* inchi key:
+
** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
+
 
* common name:
 
* common name:
** methylacrylyl-CoA
+
** an L-seryl-[tRNAser]
* molecular weight:
+
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
** methacrylyl-CoA
+
** L-SERYL-TRNA(SER)
** 2-methylprop-2-enoyl-CoA
+
** methacrylyl-coenzyme A
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MEPROPCOA-FAD-RXN]]
+
* [[SERINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 6008-91-9
+
{{#set: common name=an L-seryl-[tRNAser]}}
* PUBCHEM:
+
{{#set: common name=L-SERYL-TRNA(SER)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325]
+
{{#set: produced by=SERINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460]
+
* HMDB : HMDB01011
+
{{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
{{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}}
+
{{#set: common name=methylacrylyl-CoA}}
+
{{#set: molecular weight=831.577    }}
+
{{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}}
+
{{#set: produced by=MEPROPCOA-FAD-RXN}}
+
{{#set: reversible reaction associated=METHYLACYLYLCOA-HYDROXY-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Metabolite Charged-SER-tRNAs

  • common name:
    • an L-seryl-[tRNAser]
  • Synonym(s):
    • L-SERYL-TRNA(SER)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-seryl-[tRNAser" cannot be used as a page name in this wiki.