Difference between revisions of "PWY-7430"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7430 PWY-7430] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7430 PWY-7430] ==
* smiles:
+
* taxonomic range:
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
+
 
* common name:
 
* common name:
** (22α)-hydroxy-campest-4-en-3-one
+
** indole degradation to anthranil and anthranilate
* molecular weight:
+
** 414.67   
+
 
* Synonym(s):
 
* Synonym(s):
** (22S)-22-hydroxy-campest-4-en-3-one
 
** (22S,24R)-22-hydroxy-ergost-4-en-3-one
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''4''' reactions in the full pathway
* [[RXN-4231]]
+
* [[INDOLE-23-DIOXYGENASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-20_001720]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15187 RXN-15187]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15188 RXN-15188]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15191 RXN-15191]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01031116
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=indole degradation to anthranil and anthranilate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201842 25201842]
+
{{#set: reaction found=1}}
* CHEBI:
+
{{#set: total reaction=4}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72330 72330]
+
{{#set: completion rate=25.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15796 C15796]
+
* HMDB : HMDB12113
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N}}
+
{{#set: common name=(22α)-hydroxy-campest-4-en-3-one}}
+
{{#set: molecular weight=414.67    }}
+
{{#set: common name=(22S)-22-hydroxy-campest-4-en-3-one|(22S,24R)-22-hydroxy-ergost-4-en-3-one}}
+
{{#set: produced by=RXN-4231}}
+

Latest revision as of 19:08, 21 March 2018

Pathway PWY-7430

  • taxonomic range:
  • common name:
    • indole degradation to anthranil and anthranilate
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links