Difference between revisions of "PWY-7183"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7183 PWY-7183] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7183 PWY-7183] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** phytenoyl-CoA
+
** pyrimidine nucleobases salvage I
−
* molecular weight:
+
−
** 1056.006   
+
 
* Synonym(s):
 
* Synonym(s):
−
** E-phytenoyl-CoA
+
** uracil salvage
−
** trans-phytenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-482]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[URACIL-PRIBOSYLTRANS-RXN]]
−
* [[RXN66-480]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-03_003570]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7183 PWY-7183]
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: taxonomic range=TAX-4751}}
−
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: common name=phytenoyl-CoA}}
+
{{#set: taxonomic range=TAX-2157}}
−
{{#set: molecular weight=1056.006    }}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
+
{{#set: common name=pyrimidine nucleobases salvage I}}
−
{{#set: consumed by=RXN66-482}}
+
{{#set: common name=uracil salvage}}
−
{{#set: produced by=RXN66-480}}
+
{{#set: reaction found=1}}
 +
{{#set: total reaction=1}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 19:25, 21 March 2018

Pathway PWY-7183

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7183&oldid=26830"