|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CATAL-RXN CATAL-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C |
| + | * inchi key: |
| + | ** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J |
| * common name: | | * common name: |
− | ** Catalase-peroxidase haem | + | ** methylacrylyl-CoA |
− | ** Haem peroxidase, plant/fungal/bacterial | + | * molecular weight: |
− | ** Haem peroxidase
| + | ** 831.577 |
− | ** catalase/peroxidase
| + | |
− | ** Catalase core domain
| + | |
− | ** Catalase
| + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/1.11.1.6 EC-1.11.1.6] | + | |
− | ** [http://enzyme.expasy.org/EC/1.11.1.21 EC-1.11.1.21]
| + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** methacrylyl-CoA |
| + | ** 2-methylprop-2-enoyl-CoA |
| + | ** methacrylyl-coenzyme A |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 2 [[HYDROGEN-PEROXIDE]][c] '''=>''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[WATER]][c]
| + | * [[MEPROPCOA-FAD-RXN]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 2 hydrogen peroxide[c] '''=>''' 1 oxygen[c] '''+''' 2 H2O[c]
| + | * [[METHYLACYLYLCOA-HYDROXY-RXN]] |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-07_001420]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-07_004600]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-02_000470]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_010030]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-05_003380]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_008210]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_008230]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Ec-11_003410]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-00_008240]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-5506]], methanol oxidation to formaldehyde IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5506 PWY-5506] | + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[DETOX1-PWY-1]], reactive oxygen species degradation: [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY-1 DETOX1-PWY-1]
| + | |
− | ** '''5''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[DETOX1-PWY]], superoxide radicals degradation: [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]] | + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 6008-91-9 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20309 20309]
| + | * PUBCHEM: |
− | * LIGAND-RXN:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00009 R00009]
| + | * CHEBI: |
− | * UNIPROT: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500] |
− | ** [http://www.uniprot.org/uniprot/P11934 P11934] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P24270 P24270]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460] |
− | ** [http://www.uniprot.org/uniprot/P21179 P21179]
| + | * HMDB : HMDB01011 |
− | ** [http://www.uniprot.org/uniprot/P24168 P24168] | + | {{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}} |
− | ** [http://www.uniprot.org/uniprot/Q7M184 Q7M184] | + | {{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P0A327 P0A327]
| + | {{#set: common name=methylacrylyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P45737 P45737]
| + | {{#set: molecular weight=831.577 }} |
− | ** [http://www.uniprot.org/uniprot/P42321 P42321] | + | {{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}} |
− | ** [http://www.uniprot.org/uniprot/O28050 O28050] | + | {{#set: produced by=MEPROPCOA-FAD-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q59337 Q59337] | + | {{#set: reversible reaction associated=METHYLACYLYLCOA-HYDROXY-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P77872 P77872]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00432 P00432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15202 P15202]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06115 P06115]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07820 P07820]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17750 P17750]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13029 P13029]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17336 P17336]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04040 P04040]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25890 P25890]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04762 P04762]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29756 P29756]
| + | |
− | ** [http://www.uniprot.org/uniprot/P44390 P44390]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42234 P42234]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JRF5 Q9JRF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P94377 P94377]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZKX5 Q9ZKX5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59296 Q59296]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55306 P55306]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26901 P26901]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14412 P14412]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07145 P07145]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17598 P17598]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41136 Q41136]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30567 P30567]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30263 P30263]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29422 P29422]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30266 P30266]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37743 P37743]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33569 P33569]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18123 P18123]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55303 P55303]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01297 Q01297]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49318 P49318]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18122 P18122]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49315 P49315]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27710 Q27710]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45739 P45739]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A323 P0A323]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55307 P55307]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55308 P55308]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55305 P55305]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50979 P50979]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55110 Q55110]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12365 P12365]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73911 P73911]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77038 P77038]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25819 P25819]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48562 O48562]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43206 Q43206]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22472 O22472]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30265 P30265]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48351 P48351]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48352 P48352]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39633 Q39633]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39634 Q39634]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32290 P32290]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81336 O81336]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81337 O81337]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49317 P49317]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27487 Q27487]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8MYL7 Q8MYL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z598 Q9Z598]
| + | |
− | ** [http://www.uniprot.org/uniprot/O61235 O61235]
| + | |
− | ** [http://www.uniprot.org/uniprot/O33613 O33613]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77948 P77948]
| + | |
− | ** [http://www.uniprot.org/uniprot/O73955 O73955]
| + | |
− | ** [http://www.uniprot.org/uniprot/O59651 O59651]
| + | |
− | ** [http://www.uniprot.org/uniprot/O31066 O31066]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=Catalase-peroxidase haem}}
| + | |
− | {{#set: common name=Haem peroxidase, plant/fungal/bacterial}}
| + | |
− | {{#set: common name=Haem peroxidase}}
| + | |
− | {{#set: common name=catalase/peroxidase}} | + | |
− | {{#set: common name=Catalase core domain}}
| + | |
− | {{#set: common name=Catalase}} | + | |
− | {{#set: ec number=EC-1.11.1.6}}
| + | |
− | {{#set: ec number=EC-1.11.1.21}} | + | |
− | {{#set: gene associated=Ec-07_001420|Ec-07_004600|Ec-02_000470|Ec-00_010030|Ec-05_003380|Ec-00_008210|Ec-00_008230|Ec-11_003410|Ec-00_008240}} | + | |
− | {{#set: in pathway=PWY-5506|DETOX1-PWY-1|DETOX1-PWY}} | + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |