Difference between revisions of "Ec-16 000550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-16_000550 == * Synonym(s): ** Esi_0400_0012 ** Esi0400_0012 == Reactions associated == * Reaction: RXN-14177 ** Source: orthology-aragem...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] ==
+
== Gene Ec-16_000550 ==
* smiles:
+
** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))
+
* inchi key:
+
** InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M
+
* common name:
+
** leucodopachrome
+
* molecular weight:
+
** 194.166   
+
 
* Synonym(s):
 
* Synonym(s):
** cyclo-dopa
+
** Esi_0400_0012
** 2-carboxy-2,3-dihydro-5,6-dihydroxyindole
+
** Esi0400_0012
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-11369]]
+
* Reaction: [[RXN-14177]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
* [[RXN-8483]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0400_0012|Esi0400_0012}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202233 25202233]
+
{{#set: reaction associated=RXN-14177}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05604 C05604]
+
* HMDB : HMDB04067
+
{{#set: smiles=C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2))}}
+
{{#set: inchi key=InChIKey=JDWYRSDDJVCWPB-LURJTMIESA-M}}
+
{{#set: common name=leucodopachrome}}
+
{{#set: molecular weight=194.166    }}
+
{{#set: common name=cyclo-dopa|2-carboxy-2,3-dihydro-5,6-dihydroxyindole}}
+
{{#set: consumed by=RXN-11369}}
+
{{#set: produced by=RXN-8483}}
+

Latest revision as of 19:26, 21 March 2018

Gene Ec-16_000550

  • Synonym(s):
    • Esi_0400_0012
    • Esi0400_0012

Reactions associated

Pathways associated

External links