Difference between revisions of "PWY-7282"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL MYO-INOSITOL] == * smiles: ** C1(C(C(C(C(C1O)O)O)O)O)O * inchi key: ** InChIKey=CD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYO-INOSITOL MYO-INOSITOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C(C(C(C(C1O)O)O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
−
** InChIKey=CDAISMWEOUEBRE-GPIVLXJGSA-N
+
 
* common name:
 
* common name:
−
** myo-inositol
+
** 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast)
−
* molecular weight:
+
−
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cis-1,2,3,5-trans-4,6-Cyclohexanehexol
 
−
** dambose
 
−
** mesoinositol
 
−
** meso-inositol
 
−
** M-inositol
 
−
** 1,2,3,5/4,6 inositol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[MYO-INOSITOL-OXYGENASE-RXN]]
+
'''5''' reactions found over '''9''' reactions in the full pathway
−
* [[2.7.8.11-RXN]]
+
* [[PNKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
−
* [[RXN-10954]]
+
*** [[Ec-02_001230]]
−
* [[RXN-10953]]
+
** 2 reconstruction source(s) associated:
−
* [[RXN-7253]]
+
*** [[annotation-esiliculosus_genome]]
−
* [[RXN-10952]]
+
*** [[orthology-aragem]]
−
* [[RXN-8281]]
+
* [[PNPOXI-RXN]]
−
* [[RXN-10949]]
+
** 3 associated gene(s):
−
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
*** [[Ec-01_000340]]
−
* [[RXN0-5408]]
+
*** [[Ec-09_002030]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_006030]]
−
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
** 1 reconstruction source(s) associated:
−
* [[2.4.1.67-RXN]]
+
*** [[annotation-esiliculosus_genome]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-07_005050]]
 +
*** [[Ec-02_005190]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PYRIDOXKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-02_001230]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PYRIMSYN3-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_006870]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-4-DEHYDROGENASE-RXN PYRIDOXINE-4-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14506 RXN-14506]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14507 RXN-14507]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-3797 RXN3O-3797]
 
== External links  ==
 
== External links  ==
−
* CAS : 6917-35-7
+
{{#set: taxonomic range=TAX-4751}}
−
* CAS : 87-89-8
+
{{#set: common name=4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast)}}
−
* BIGG : 33990
+
{{#set: reaction found=5}}
−
* DRUGBANK : DB03106
+
{{#set: total reaction=9}}
−
* PUBCHEM:
+
{{#set: completion rate=56.0}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=892 892]
+
−
* KNAPSACK : C00001164
+
−
* HMDB : HMDB00211
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00137 C00137]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.868.html 868]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17268 17268]
+
−
* METABOLIGHTS : MTBLC17268
+
−
{{#set: smiles=C1(C(C(C(C(C1O)O)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=CDAISMWEOUEBRE-GPIVLXJGSA-N}}
+
−
{{#set: common name=myo-inositol}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: common name=cis-1,2,3,5-trans-4,6-Cyclohexanehexol|dambose|mesoinositol|meso-inositol|M-inositol|1,2,3,5/4,6 inositol}}
+
−
{{#set: consumed by=MYO-INOSITOL-OXYGENASE-RXN|2.7.8.11-RXN}}
+
−
{{#set: produced by=RXN-10954|RXN-10953|RXN-7253|RXN-10952|RXN-8281|RXN-10949|MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN0-5408}}
+
−
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN|2.4.1.67-RXN}}
+

Latest revision as of 19:26, 21 March 2018

Pathway PWY-7282

  • taxonomic range:
  • common name:
    • 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast)
  • Synonym(s):

Reaction(s) found

5 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7282&oldid=26866"