Difference between revisions of "CPD-14928"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9463 RXN-9463] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-1,2-fucosyltransferase,...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9463 RXN-9463] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
 +
* inchi key:
 +
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
 
* common name:
 
* common name:
** alpha-1,2-fucosyltransferase, putative
+
** phytenoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.4.1 EC-2.4.1]
+
** 1056.006   
 
* Synonym(s):
 
* Synonym(s):
 +
** E-phytenoyl-CoA
 +
** trans-phytenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN66-482]]
** 1 [[Xyloglucans-Galactose-23]][c] '''+''' 1 [[GUANOSINE_DIPHOSPHATE_FUCOSE]][c] '''=>''' 1 [[GDP]][c] '''+''' 1 [[XLFG-Xyloglucans]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN66-480]]
** 1 an XLLG xylogulcan[c] '''+''' 1 GDP-L-fucose[c] '''=>''' 1 GDP[c] '''+''' 1 an XLFG xylogulcan[c] '''+''' 1 H+[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-22_001510]]
+
** ESILICULOSUS_GENOME
+
***AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
* [[PWY-5936]], xyloglucan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5936 PWY-5936]
+
** '''1''' reactions found over '''6''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=alpha-1,2-fucosyltransferase, putative}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
{{#set: ec number=EC-2.4.1}}
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: gene associated=Ec-22_001510}}
+
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
{{#set: in pathway=PWY-5936}}
+
{{#set: common name=phytenoyl-CoA}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=1056.006    }}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN66-482}}
 +
{{#set: produced by=RXN66-480}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-14928

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
  • common name:
    • phytenoyl-CoA
  • molecular weight:
    • 1056.006
  • Synonym(s):
    • E-phytenoyl-CoA
    • trans-phytenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.