Difference between revisions of "2Fe-2S-proteins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2Fe-2S-proteins 2Fe-2S-proteins] == * common name: ** an [2Fe-2S] cluster protein * Synonym(s):...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2Fe-2S-proteins 2Fe-2S-proteins] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an [2Fe-2S] cluster protein |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a holo-[2Fe-2S] cluster protein |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14390]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an [2Fe-2S] cluster protein}} | |
− | + | {{#set: common name=a holo-[2Fe-2S] cluster protein}} | |
− | + | {{#set: produced by=RXN-14390}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: produced by | + | |
− | + |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite 2Fe-2S-proteins
- common name:
- an [2Fe-2S] cluster protein
- Synonym(s):
- a holo-[2Fe-2S] cluster protein
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [2Fe-2S] cluster protein" cannot be used as a page name in this wiki.
"a holo-[2Fe-2S] cluster protein" cannot be used as a page name in this wiki.