Difference between revisions of "PWY-6307"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6307 PWY-6307] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6307 PWY-6307] ==
* smiles:
+
* taxonomic range:
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
* inchi key:
+
** InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
+
 
* common name:
 
* common name:
** (22α)-hydroxy-campesterol
+
** L-tryptophan degradation X (mammalian, via tryptamine)
* molecular weight:
+
** 416.686   
+
 
* Synonym(s):
 
* Synonym(s):
** (22S)-22-hydroxy-campesterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''4''' reactions in the full pathway
* [[RXN-4225]]
+
* [[RXN-10715]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-11_002450]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10717 RXN-10717]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1401 RXN-1401]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01031115
+
{{#set: taxonomic range=TAX-40674}}
* PUBCHEM:
+
{{#set: common name=L-tryptophan degradation X (mammalian, via tryptamine)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11133505 11133505]
+
{{#set: reaction found=1}}
* CHEMSPIDER:
+
{{#set: total reaction=4}}
** [http://www.chemspider.com/Chemical-Structure.9308624.html 9308624]
+
{{#set: completion rate=25.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72331 72331]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15795 C15795]
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N}}
+
{{#set: common name=(22α)-hydroxy-campesterol}}
+
{{#set: molecular weight=416.686    }}
+
{{#set: common name=(22S)-22-hydroxy-campesterol}}
+
{{#set: produced by=RXN-4225}}
+

Latest revision as of 19:26, 21 March 2018

Pathway PWY-6307

  • taxonomic range:
  • common name:
    • L-tryptophan degradation X (mammalian, via tryptamine)
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links