Difference between revisions of "PWY-7170"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7170 PWY-7170] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-30...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7170 PWY-7170] ==
* smiles:
+
* taxonomic range:
** CC(CC([N+])C([O-])=O)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
+
 
* common name:
 
* common name:
** L-leucine
+
** phytochromobilin biosynthesis
* molecular weight:
+
** 131.174   
+
 
* Synonym(s):
 
* Synonym(s):
** (2S)-α-2-amino-4-methylvaleric acid
 
** L
 
** leu
 
** leucine
 
** 2-amino-4-methylvaleric acid
 
** (2S)-α-leucine
 
** L-leu
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[LEUCINE--TRNA-LIGASE-RXN]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
* [[biomass_rxn]]
+
* [[1.3.7.4-RXN]]
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-22_000060]]
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13968 RXN-13968]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17523 RXN-17523]
 
== External links  ==
 
== External links  ==
* NCI:
+
{{#set: taxonomic range=TAX-3041}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709]
+
{{#set: taxonomic range=TAX-33090}}
* CAS : 61-90-5
+
{{#set: common name=phytochromobilin biosynthesis}}
* BIGG : 33942
+
{{#set: reaction found=1}}
* PUBCHEM:
+
{{#set: total reaction=3}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798]
+
{{#set: completion rate=33.0}}
* HMDB : HMDB00687
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427]
+
* METABOLIGHTS : MTBLC57427
+
{{#set: smiles=CC(CC([N+])C([O-])=O)C}}
+
{{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}}
+
{{#set: common name=L-leucine}}
+
{{#set: molecular weight=131.174    }}
+
{{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}}
+
{{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|biomass_rxn}}
+
{{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERLEU-RXN}}
+

Latest revision as of 19:26, 21 March 2018

Pathway PWY-7170

  • taxonomic range:
  • common name:
    • phytochromobilin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links