Difference between revisions of "PWY-7007"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == * smiles: ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007] ==
* smiles:
+
* taxonomic range:
** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E
+
 
* common name:
 
* common name:
** cobalt-precorrin-2
+
** methyl ketone biosynthesis (engineered)
* molecular weight:
+
** 912.701   
+
 
* Synonym(s):
 
* Synonym(s):
** cobalt-dihydrosirohydrochlorin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[ACYL-COA-OXIDASE-RXN]]
* [[RXN-8759]]
+
** 3 associated gene(s):
 +
*** [[Ec-22_002920]]
 +
*** [[Ec-26_004320]]
 +
*** [[Ec-08_006390]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ENOYL-COA-HYDRAT-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-06_001380]]
 +
*** [[Ec-16_003560]]
 +
*** [[Ec-16_001250]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[OHACYL-COA-DEHYDROG-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-19_005290]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BUTYRATE--COA-LIGASE-RXN BUTYRATE--COA-LIGASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13247 RXN-13247]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13248 RXN-13248]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820486 91820486]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=methyl ketone biosynthesis (engineered)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3790 3790]
+
{{#set: reaction found=3}}
{{#set: smiles=CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]}}
+
{{#set: total reaction=6}}
{{#set: inchi key=InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E}}
+
{{#set: completion rate=50.0}}
{{#set: common name=cobalt-precorrin-2}}
+
{{#set: molecular weight=912.701    }}
+
{{#set: common name=cobalt-dihydrosirohydrochlorin}}
+
{{#set: reversible reaction associated=RXN-8759}}
+

Latest revision as of 19:26, 21 March 2018

Pathway PWY-7007

  • taxonomic range:
  • common name:
    • methyl ketone biosynthesis (engineered)
  • Synonym(s):

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links